C19H20N2O4 — CID 167019129
3-(2-hydroxy-3-oxo-2,4-dihydroquinoxalin-1-yl)propyl 4-methylbenzoate (PubChem CID 167019129) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-(2-hydroxy-3-oxo-2,4-dihydroquinoxalin-1-yl)propyl 4-methylbenzoate.
| Compound Name | 3-(2-hydroxy-3-oxo-2,4-dihydroquinoxalin-1-yl)propyl 4-methylbenzoate |
|---|---|
| PubChem CID | 167019129 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3-(2-hydroxy-3-oxo-2,4-dihydroquinoxalin-1-yl)propyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCCCN2c3ccccc3NC(=O)C2O)cc1 |
| InChI | InChI=1S/C19H20N2O4/c1-13-7-9-14(10-8-13)19(24)25-12-4-11-21-16-6-3-2-5-15(16)20-17(22)18(21)23/h2-3,5-10,18,23H,4,11-12H2,1H3,(H,20,22) |
| InChIKey | KVPUEFZCHRKNPW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|