C23H48O3SiSn — CID 73077255
2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-tributylstannyl-2,3-dihydrofuran-3-ol (PubChem CID 73077255) has the molecular formula C23H48O3SiSn and a molecular weight of 519.43 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-tributylstannyl-2,3-dihydrofuran-3-ol.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-tributylstannyl-2,3-dihydrofuran-3-ol |
|---|---|
| PubChem CID | 73077255 |
| Molecular Formula | C23H48O3SiSn |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-tributylstannyl-2,3-dihydrofuran-3-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=CC(O)C(CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C11H21O3Si.3C4H9.Sn/c1-11(2,3)15(4,5)14-8-10-9(12)6-7-13-10;3*1-3-4-2;/h6,9-10,12H,8H2,1-5H3;3*1,3-4H2,2H3; |
| InChIKey | KEFKVVAZTPCBBJ-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|