C18H29NO5 — CID 7307934
cis-methyl (1S,5S)-5-butanoyl-4-[(2R)-1-hydroxybutan-2-yl]imino-2,2-dimethyl-6-oxocyclohexane-1-carboxylate (PubChem CID 7307934) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is cis-methyl (1S,5S)-5-butanoyl-4-[(2R)-1-hydroxybutan-2-yl]imino-2,2-dimethyl-6-oxocyclohexane-1-carboxylate.
| Compound Name | cis-methyl (1S,5S)-5-butanoyl-4-[(2R)-1-hydroxybutan-2-yl]imino-2,2-dimethyl-6-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7307934 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | cis-methyl (1S,5S)-5-butanoyl-4-[(2R)-1-hydroxybutan-2-yl]imino-2,2-dimethyl-6-oxocyclohexane-1-carboxylate |
| SMILES | CCCC(=O)[C@H]1C(=O)[C@@H](C(=O)OC)C(C)(C)C/C1=N\[C@H](CC)CO |
| InChI | InChI=1S/C18H29NO5/c1-6-8-13(21)14-12(19-11(7-2)10-20)9-18(3,4)15(16(14)22)17(23)24-5/h11,14-15,20H,6-10H2,1-5H3/b19-12+/t11-,14+,15+/m1/s1 |
| InChIKey | UCJIFLHYXMYRDP-VOPVXQGOSA-N |
| XLogP | 1.97 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|