C26H30O10 — CID 73087165
[4,5-dihydroxy-2-(hydroxymethyl)-6-[4-hydroxy-2-(3-methylbut-2-enyl)phenoxy]oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 73087165) has the molecular formula C26H30O10 and a molecular weight of 502.52 g/mol. Its IUPAC name is [4,5-dihydroxy-2-(hydroxymethyl)-6-[4-hydroxy-2-(3-methylbut-2-enyl)phenoxy]oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [4,5-dihydroxy-2-(hydroxymethyl)-6-[4-hydroxy-2-(3-methylbut-2-enyl)phenoxy]oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 73087165 |
| Molecular Formula | C26H30O10 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | [4,5-dihydroxy-2-(hydroxymethyl)-6-[4-hydroxy-2-(3-methylbut-2-enyl)phenoxy]oxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CC(C)=CCc1cc(O)ccc1OC1OC(CO)C(OC(=O)C=Cc2ccc(O)c(O)c2)C(O)C1O |
| InChI | InChI=1S/C26H30O10/c1-14(2)3-6-16-12-17(28)7-9-20(16)34-26-24(33)23(32)25(21(13-27)35-26)36-22(31)10-5-15-4-8-18(29)19(30)11-15/h3-5,7-12,21,23-30,32-33H,6,13H2,1-2H3 |
| InChIKey | NCCLLRBZVMPSLE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|