About 7-methyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one
7-methyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one (PubChem CID 73094337) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is 7-methyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one.
Analyze 7-methyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one?
The IUPAC name of 7-methyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one (CID 73094337) is 7-methyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one.
What is the SMILES notation for 7-methyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one?
The canonical SMILES for 7-methyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one is CC1OC2C=CC(=O)C1O2.
What is the InChIKey of 7-methyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one?
The InChIKey is QUYKJTZOIOVQMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c1-4-7-5(8)2-3-6(9-4)10-7/h2-4,6-7H,1H3.
What are the key properties of 7-methyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one?
7-methyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one has a molecular weight of 140.14 g/mol, XLogP of 0.26, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one is sourced from PubChem (CID 73094337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).