C28H38O4 — CID 73105600
3,6-dihydroxy-4,6a,6b,8a,11,14a-hexamethyl-6,6a,7,8,9,11,12,12a,13,14-decahydropicene-2,10-dione (PubChem CID 73105600) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is 3,6-dihydroxy-4,6a,6b,8a,11,14a-hexamethyl-6,6a,7,8,9,11,12,12a,13,14-decahydropicene-2,10-dione.
| Compound Name | 3,6-dihydroxy-4,6a,6b,8a,11,14a-hexamethyl-6,6a,7,8,9,11,12,12a,13,14-decahydropicene-2,10-dione |
|---|---|
| PubChem CID | 73105600 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | 3,6-dihydroxy-4,6a,6b,8a,11,14a-hexamethyl-6,6a,7,8,9,11,12,12a,13,14-decahydropicene-2,10-dione |
| SMILES | CC1=C(O)C(=O)C=C2C1=CC(O)C1C2(C)CCC2(C)C3CC(C)C(=O)CC3(C)CCC12C |
| InChI | InChI=1S/C28H38O4/c1-15-11-22-25(3,14-21(15)31)7-9-28(6)24-20(30)12-17-16(2)23(32)19(29)13-18(17)26(24,4)8-10-27(22,28)5/h12-13,15,20,22,24,30,32H,7-11,14H2,1-6H3 |
| InChIKey | HVRSOVWJUJGHSI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |