C16H23N2O3S+ — CID 7310737
[(1R,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl N-(thiophene-2-carbonyl)carbamate (PubChem CID 7310737) has the molecular formula C16H23N2O3S+ and a molecular weight of 323.44 g/mol. Its IUPAC name is [(1R,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl N-(thiophene-2-carbonyl)carbamate.
| Compound Name | [(1R,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl N-(thiophene-2-carbonyl)carbamate |
|---|---|
| PubChem CID | 7310737 |
| Molecular Formula | C16H23N2O3S+ |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | [(1R,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl N-(thiophene-2-carbonyl)carbamate |
| SMILES | O=C(NC(=O)c1cccs1)OC[C@@H]1CCC[NH+]2CCCC[C@@H]12 |
| InChI | InChI=1S/C16H22N2O3S/c19-15(14-7-4-10-22-14)17-16(20)21-11-12-5-3-9-18-8-2-1-6-13(12)18/h4,7,10,12-13H,1-3,5-6,8-9,11H2,(H,17,19,20)/p+1/t12-,13-/m0/s1 |
| InChIKey | OYSBOQSTNMBOFY-STQMWFEESA-O |
| XLogP | 1.46 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |