C22H35N2O4+ — CID 7312851
N-ethyl-N-(2-methylprop-2-enyl)-1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-1-ium-4-carboxamide (PubChem CID 7312851) has the molecular formula C22H35N2O4+ and a molecular weight of 391.53 g/mol. Its IUPAC name is N-ethyl-N-(2-methylprop-2-enyl)-1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-1-ium-4-carboxamide.
| Compound Name | N-ethyl-N-(2-methylprop-2-enyl)-1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7312851 |
| Molecular Formula | C22H35N2O4+ |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | N-ethyl-N-(2-methylprop-2-enyl)-1-[(3,4,5-trimethoxyphenyl)methyl]piperidin-1-ium-4-carboxamide |
| SMILES | C=C(C)CN(CC)C(=O)C1CC[NH+](Cc2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C22H34N2O4/c1-7-24(14-16(2)3)22(25)18-8-10-23(11-9-18)15-17-12-19(26-4)21(28-6)20(13-17)27-5/h12-13,18H,2,7-11,14-15H2,1,3-6H3/p+1 |
| InChIKey | NJIRFQUTWKLOJZ-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 52.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|