C32H26ClN3O5 — CID 73130224
5-benzoyl-6-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-9,9-dimethyl-6,6a,8,10-tetrahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 73130224) has the molecular formula C32H26ClN3O5 and a molecular weight of 568.03 g/mol. Its IUPAC name is 5-benzoyl-6-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-9,9-dimethyl-6,6a,8,10-tetrahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 5-benzoyl-6-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-9,9-dimethyl-6,6a,8,10-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 73130224 |
| Molecular Formula | C32H26ClN3O5 |
| Molecular Weight | 568.03 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | 5-benzoyl-6-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-9,9-dimethyl-6,6a,8,10-tetrahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CC1(C)CC(=O)C2C(=Nc3ccccc3N(C(=O)c3ccccc3)C2c2ccc(-c3ccc([N+](=O)[O-])cc3Cl)o2)C1 |
| InChI | InChI=1S/C32H26ClN3O5/c1-32(2)17-24-29(26(37)18-32)30(28-15-14-27(41-28)21-13-12-20(36(39)40)16-22(21)33)35(25-11-7-6-10-23(25)34-24)31(38)19-8-4-3-5-9-19/h3-16,29-30H,17-18H2,1-2H3 |
| InChIKey | RRBLIYUECHZSCX-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 106.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.03 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|