C24H18ClN5O5S — CID 6416316
1-[6-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-3-methylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]propan-1-one (PubChem CID 6416316) has the molecular formula C24H18ClN5O5S and a molecular weight of 523.96 g/mol. Its IUPAC name is 1-[6-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-3-methylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]propan-1-one.
| Compound Name | 1-[6-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-3-methylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]propan-1-one |
|---|---|
| PubChem CID | 6416316 |
| Molecular Formula | C24H18ClN5O5S |
| Molecular Weight | 523.96 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 1-[6-[5-(2-chloro-4-nitrophenyl)furan-2-yl]-3-methylsulfanyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-7-yl]propan-1-one |
| SMILES | CCC(=O)N1c2ccccc2-c2nnc(SC)nc2OC1c1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C24H18ClN5O5S/c1-3-20(31)29-17-7-5-4-6-15(17)21-22(26-24(36-2)28-27-21)35-23(29)19-11-10-18(34-19)14-9-8-13(30(32)33)12-16(14)25/h4-12,23H,3H2,1-2H3 |
| InChIKey | YDKLEPODZCLGLD-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 124.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.96 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|