C23H22N6O6 — CID 73135046
1-(4-acetylphenyl)-3-[6-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]urea (PubChem CID 73135046) has the molecular formula C23H22N6O6 and a molecular weight of 478.47 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[6-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]urea.
| Compound Name | 1-(4-acetylphenyl)-3-[6-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]urea |
|---|---|
| PubChem CID | 73135046 |
| Molecular Formula | C23H22N6O6 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[6-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]urea |
| SMILES | CC(=O)c1ccc(NC(=O)NC2COC3C2OCC3n2nnnc2-c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C23H22N6O6/c1-12(30)13-2-5-15(6-3-13)24-23(31)25-16-9-32-21-17(10-33-20(16)21)29-22(26-27-28-29)14-4-7-18-19(8-14)35-11-34-18/h2-8,16-17,20-21H,9-11H2,1H3,(H2,24,25,31) |
| InChIKey | TWWABHCRJRCACB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |