C14H17N3O2S2 — CID 73167804
4-methyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)thiadiazole-5-carboxamide (PubChem CID 73167804) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-methyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)thiadiazole-5-carboxamide.
| Compound Name | 4-methyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 73167804 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 4-methyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)thiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)N(Cc1cccs1)C1CCOCC1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-10-13(21-16-15-10)14(18)17(9-12-3-2-8-20-12)11-4-6-19-7-5-11/h2-3,8,11H,4-7,9H2,1H3 |
| InChIKey | HGADANOAGDPNIZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |