C10H9N3O3S — CID 7317448
5-(furan-2-ylmethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7317448) has the molecular formula C10H9N3O3S and a molecular weight of 251.27 g/mol. Its IUPAC name is 5-(furan-2-ylmethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-(furan-2-ylmethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7317448 |
| Molecular Formula | C10H9N3O3S |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 5-(furan-2-ylmethyliminomethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1/C=N/Cc1ccco1 |
| InChI | InChI=1S/C10H9N3O3S/c14-8-7(9(15)13-10(17)12-8)5-11-4-6-2-1-3-16-6/h1-3,5,7H,4H2,(H2,12,13,14,15,17)/b11-5+ |
| InChIKey | ACRMPVGBZBSLEP-VZUCSPMQSA-N |
| XLogP | -0.00 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|