C22H23N3O3S — CID 7639853
5-[[(3R)-3-(furan-2-yl)-3-(4-methylphenyl)propyl]iminomethyl]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7639853) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is 5-[[(3R)-3-(furan-2-yl)-3-(4-methylphenyl)propyl]iminomethyl]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[(3R)-3-(furan-2-yl)-3-(4-methylphenyl)propyl]iminomethyl]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7639853 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 5-[[(3R)-3-(furan-2-yl)-3-(4-methylphenyl)propyl]iminomethyl]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=CCN1C(=O)C(/C=N/CC[C@H](c2ccc(C)cc2)c2ccco2)C(=O)NC1=S |
| InChI | InChI=1S/C22H23N3O3S/c1-3-12-25-21(27)18(20(26)24-22(25)29)14-23-11-10-17(19-5-4-13-28-19)16-8-6-15(2)7-9-16/h3-9,13-14,17-18H,1,10-12H2,2H3,(H,24,26,29)/b23-14+/t17-,18?/m1/s1 |
| InChIKey | RMZZCNXEUUVHEQ-OKSHBILDSA-N |
| XLogP | 3.23 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|