C24H19N3O2S — CID 7358715
2-sulfanylidene-5-(trityliminomethyl)-1,3-diazinane-4,6-dione (PubChem CID 7358715) has the molecular formula C24H19N3O2S and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-sulfanylidene-5-(trityliminomethyl)-1,3-diazinane-4,6-dione.
| Compound Name | 2-sulfanylidene-5-(trityliminomethyl)-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7358715 |
| Molecular Formula | C24H19N3O2S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-sulfanylidene-5-(trityliminomethyl)-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1/C=N/C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H19N3O2S/c28-21-20(22(29)27-23(30)26-21)16-25-24(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16,20H,(H2,26,27,28,29,30)/b25-16+ |
| InChIKey | GOAOSKOUJRMQHY-PCLIKHOPSA-N |
| XLogP | 3.20 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|