C21H16F3N — CID 141427840
2,2,2-trifluoro-N-tritylethanimine (PubChem CID 141427840) has the molecular formula C21H16F3N and a molecular weight of 339.36 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-tritylethanimine.
| Compound Name | 2,2,2-trifluoro-N-tritylethanimine |
|---|---|
| PubChem CID | 141427840 |
| Molecular Formula | C21H16F3N |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2,2,2-trifluoro-N-tritylethanimine |
| SMILES | FC(F)(F)/C=N/C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16F3N/c22-20(23,24)16-25-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16H/b25-16+ |
| InChIKey | YDIZMQGDOXSGBI-PCLIKHOPSA-N |
| XLogP | 5.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|