C20H32O3 — CID 73190632
13-(2-hydroxypropan-2-yl)-2,6,10-trimethyl-15-oxabicyclo[10.2.1]pentadeca-5,9,13-trien-2-ol (PubChem CID 73190632) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 13-(2-hydroxypropan-2-yl)-2,6,10-trimethyl-15-oxabicyclo[10.2.1]pentadeca-5,9,13-trien-2-ol.
| Compound Name | 13-(2-hydroxypropan-2-yl)-2,6,10-trimethyl-15-oxabicyclo[10.2.1]pentadeca-5,9,13-trien-2-ol |
|---|---|
| PubChem CID | 73190632 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 13-(2-hydroxypropan-2-yl)-2,6,10-trimethyl-15-oxabicyclo[10.2.1]pentadeca-5,9,13-trien-2-ol |
| SMILES | CC1=CCCC(C)(O)C2C=C(C(C)(C)O)C(CC(C)=CCC1)O2 |
| InChI | InChI=1S/C20H32O3/c1-14-8-6-9-15(2)12-17-16(19(3,4)21)13-18(23-17)20(5,22)11-7-10-14/h9-10,13,17-18,21-22H,6-8,11-12H2,1-5H3 |
| InChIKey | YMMMNSPQHCJJNL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|