C19H21F3N2O3S — CID 73204197
N-[6-(dimethylamino)-4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl]-2,3,4-trifluorobenzenesulfonamide (PubChem CID 73204197) has the molecular formula C19H21F3N2O3S and a molecular weight of 414.45 g/mol. Its IUPAC name is N-[6-(dimethylamino)-4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl]-2,3,4-trifluorobenzenesulfonamide.
| Compound Name | N-[6-(dimethylamino)-4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl]-2,3,4-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 73204197 |
| Molecular Formula | C19H21F3N2O3S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[6-(dimethylamino)-4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl]-2,3,4-trifluorobenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(F)c(F)c2F)c2c1CC(N(C)C)CC2 |
| InChI | InChI=1S/C19H21F3N2O3S/c1-24(2)11-4-5-12-13(10-11)16(27-3)8-7-15(12)23-28(25,26)17-9-6-14(20)18(21)19(17)22/h6-9,11,23H,4-5,10H2,1-3H3 |
| InChIKey | NUZZVPBZKXPDCK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|