C21H22N2O3 — CID 7321014
(E)-3-(2-methoxyphenyl)-2-(2-oxo-1-pyridinyl)-N,N-bis(prop-2-enyl)prop-2-enamide (PubChem CID 7321014) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (E)-3-(2-methoxyphenyl)-2-(2-oxo-1-pyridinyl)-N,N-bis(prop-2-enyl)prop-2-enamide.
| Compound Name | (E)-3-(2-methoxyphenyl)-2-(2-oxo-1-pyridinyl)-N,N-bis(prop-2-enyl)prop-2-enamide |
|---|---|
| PubChem CID | 7321014 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (E)-3-(2-methoxyphenyl)-2-(2-oxo-1-pyridinyl)-N,N-bis(prop-2-enyl)prop-2-enamide |
| SMILES | C=CCN(CC=C)C(=O)/C(=C\c1ccccc1OC)n1ccccc1=O |
| InChI | InChI=1S/C21H22N2O3/c1-4-13-22(14-5-2)21(25)18(23-15-9-8-12-20(23)24)16-17-10-6-7-11-19(17)26-3/h4-12,15-16H,1-2,13-14H2,3H3/b18-16+ |
| InChIKey | QQDWTKNFVDCBKL-FBMGVBCBSA-N |
| XLogP | 3.06 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|