C21H22N4O — CID 73214273
(E)-3-[2-phenyl-1-(trideuteriomethyl)pyrrolo[2,3-b]pyridin-3-yl]-1-piperazin-1-ylprop-2-en-1-one (PubChem CID 73214273) has the molecular formula C21H22N4O and a molecular weight of 349.45 g/mol. Its IUPAC name is (E)-3-[2-phenyl-1-(trideuteriomethyl)pyrrolo[2,3-b]pyridin-3-yl]-1-piperazin-1-ylprop-2-en-1-one.
| Compound Name | (E)-3-[2-phenyl-1-(trideuteriomethyl)pyrrolo[2,3-b]pyridin-3-yl]-1-piperazin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 73214273 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (E)-3-[2-phenyl-1-(trideuteriomethyl)pyrrolo[2,3-b]pyridin-3-yl]-1-piperazin-1-ylprop-2-en-1-one |
| SMILES | [2H]C([2H])([2H])n1c(-c2ccccc2)c(/C=C/C(=O)N2CCNCC2)c2cccnc21 |
| InChI | InChI=1S/C21H22N4O/c1-24-20(16-6-3-2-4-7-16)17(18-8-5-11-23-21(18)24)9-10-19(26)25-14-12-22-13-15-25/h2-11,22H,12-15H2,1H3/b10-9+/i1D3 |
| InChIKey | SYRGSUZIABWVAZ-LEWZCUBUSA-N |
| XLogP | 2.69 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|