C30H52O2 — CID 73233609
2-[3a,9b,11a-trimethyl-1-(6-methylhept-5-en-2-yl)-1,2,3,3b,4,5,7,8,9,9a,10,11-dodecahydroindeno[5,4-f]chromen-5a-yl]propan-2-ol (PubChem CID 73233609) has the molecular formula C30H52O2 and a molecular weight of 444.74 g/mol. Its IUPAC name is 2-[3a,9b,11a-trimethyl-1-(6-methylhept-5-en-2-yl)-1,2,3,3b,4,5,7,8,9,9a,10,11-dodecahydroindeno[5,4-f]chromen-5a-yl]propan-2-ol.
| Compound Name | 2-[3a,9b,11a-trimethyl-1-(6-methylhept-5-en-2-yl)-1,2,3,3b,4,5,7,8,9,9a,10,11-dodecahydroindeno[5,4-f]chromen-5a-yl]propan-2-ol |
|---|---|
| PubChem CID | 73233609 |
| Molecular Formula | C30H52O2 |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.40 |
| IUPAC Name | 2-[3a,9b,11a-trimethyl-1-(6-methylhept-5-en-2-yl)-1,2,3,3b,4,5,7,8,9,9a,10,11-dodecahydroindeno[5,4-f]chromen-5a-yl]propan-2-ol |
| SMILES | CC(C)=CCCC(C)C1CCC2(C)C3CCC4(C(C)(C)O)OCCCC4C3(C)CCC12C |
| InChI | InChI=1S/C30H52O2/c1-21(2)11-9-12-22(3)23-14-16-29(8)24-15-17-30(26(4,5)31)25(13-10-20-32-30)27(24,6)18-19-28(23,29)7/h11,22-25,31H,9-10,12-20H2,1-8H3 |
| InChIKey | JNEHSZSTSJZRIW-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|