C16H11BrN3O4- — CID 7323591
2-[(Z)-[[2-(2-bromoanilino)-2-oxoacetyl]hydrazinylidene]methyl]benzoate (PubChem CID 7323591) has the molecular formula C16H11BrN3O4- and a molecular weight of 389.19 g/mol. Its IUPAC name is 2-[(Z)-[[2-(2-bromoanilino)-2-oxoacetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | 2-[(Z)-[[2-(2-bromoanilino)-2-oxoacetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 7323591 |
| Molecular Formula | C16H11BrN3O4- |
| Molecular Weight | 389.19 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | 2-[(Z)-[[2-(2-bromoanilino)-2-oxoacetyl]hydrazinylidene]methyl]benzoate |
| SMILES | O=C(N/N=C\c1ccccc1C(=O)[O-])C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C16H12BrN3O4/c17-12-7-3-4-8-13(12)19-14(21)15(22)20-18-9-10-5-1-2-6-11(10)16(23)24/h1-9H,(H,19,21)(H,20,22)(H,23,24)/p-1/b18-9- |
| InChIKey | FCDPIVWKAUUIEG-NVMNQCDNSA-M |
| XLogP | 0.90 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|