C20H21N3O2 — CID 73259374
1-methyl-5-(4-phenylphenyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 73259374) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-methyl-5-(4-phenylphenyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-methyl-5-(4-phenylphenyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 73259374 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-methyl-5-(4-phenylphenyl)-4a,5,6,7,8,8a-hexahydropyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CN1C(=O)NC(=O)C2C(c3ccc(-c4ccccc4)cc3)CCNC21 |
| InChI | InChI=1S/C20H21N3O2/c1-23-18-17(19(24)22-20(23)25)16(11-12-21-18)15-9-7-14(8-10-15)13-5-3-2-4-6-13/h2-10,16-18,21H,11-12H2,1H3,(H,22,24,25) |
| InChIKey | CQPCIKLPDHTTKH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |