C18H27N5O — CID 85464597
2-(4-methylpiperazin-1-yl)-5-phenyl-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 85464597) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-5-phenyl-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-methylpiperazin-1-yl)-5-phenyl-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 85464597 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-5-phenyl-2,3,4a,5,6,7,8,8a-octahydro-1H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | CN1CCN(C2NC(=O)C3C(NCCC3c3ccccc3)N2)CC1 |
| InChI | InChI=1S/C18H27N5O/c1-22-9-11-23(12-10-22)18-20-16-15(17(24)21-18)14(7-8-19-16)13-5-3-2-4-6-13/h2-6,14-16,18-20H,7-12H2,1H3,(H,21,24) |
| InChIKey | CADSNQMSWXYADF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |