C17H18BrN5O3S — CID 73280985
7-[3-(1,3-benzoxazol-2-ylsulfanyl)-2-methylpropyl]-8-bromo-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 73280985) has the molecular formula C17H18BrN5O3S and a molecular weight of 452.33 g/mol. Its IUPAC name is 7-[3-(1,3-benzoxazol-2-ylsulfanyl)-2-methylpropyl]-8-bromo-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 7-[3-(1,3-benzoxazol-2-ylsulfanyl)-2-methylpropyl]-8-bromo-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 73280985 |
| Molecular Formula | C17H18BrN5O3S |
| Molecular Weight | 452.33 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | 7-[3-(1,3-benzoxazol-2-ylsulfanyl)-2-methylpropyl]-8-bromo-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CC(CSc1nc2ccccc2o1)CN1C(Br)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C17H18BrN5O3S/c1-9(8-27-17-19-10-5-3-4-6-11(10)26-17)7-23-12-13(20-15(23)18)22(2)16(25)21-14(12)24/h3-6,9,12-13H,7-8H2,1-2H3,(H,21,24,25) |
| InChIKey | LMUCCJPEVINUOA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|