C18H28N6O3 — CID 73284275
6-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione (PubChem CID 73284275) has the molecular formula C18H28N6O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 6-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 73284275 |
| Molecular Formula | C18H28N6O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 6-[2-(2,6-dimethylmorpholin-4-yl)ethyl]-4,7,8-trimethyl-4a,9a-dihydropurino[7,8-a]imidazole-1,3-dione |
| SMILES | CC1=C(C)N2C(=NC3C2C(=O)NC(=O)N3C)N1CCN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C18H28N6O3/c1-10-8-22(9-11(2)27-10)6-7-23-12(3)13(4)24-14-15(19-17(23)24)21(5)18(26)20-16(14)25/h10-11,14-15H,6-9H2,1-5H3,(H,20,25,26) |
| InChIKey | FHAJHRMPLDDGIE-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |