C15H23NO3 — CID 73292087
(2S,3R,4R,5R,6R)-2-methyl-6-(3-phenylpropyl)piperidine-3,4,5-triol (PubChem CID 73292087) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-methyl-6-(3-phenylpropyl)piperidine-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6R)-2-methyl-6-(3-phenylpropyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 73292087 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-methyl-6-(3-phenylpropyl)piperidine-3,4,5-triol |
| SMILES | C[C@@H]1N[C@H](CCCc2ccccc2)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H23NO3/c1-10-13(17)15(19)14(18)12(16-10)9-5-8-11-6-3-2-4-7-11/h2-4,6-7,10,12-19H,5,8-9H2,1H3/t10-,12+,13+,14+,15+/m0/s1 |
| InChIKey | QBPZWWWMCXGUGR-URWOTSEESA-N |
| XLogP | 0.45 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |