C27H25NO4S — CID 73292278
2-(4-methylphenyl)sulfonyl-4-(naphthalene-1-carbonyl)-1,3,4,5,6,7-hexahydroisoquinolin-8-one (PubChem CID 73292278) has the molecular formula C27H25NO4S and a molecular weight of 459.57 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-4-(naphthalene-1-carbonyl)-1,3,4,5,6,7-hexahydroisoquinolin-8-one.
| Compound Name | 2-(4-methylphenyl)sulfonyl-4-(naphthalene-1-carbonyl)-1,3,4,5,6,7-hexahydroisoquinolin-8-one |
|---|---|
| PubChem CID | 73292278 |
| Molecular Formula | C27H25NO4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-4-(naphthalene-1-carbonyl)-1,3,4,5,6,7-hexahydroisoquinolin-8-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3=C(CCCC3=O)C(C(=O)c3cccc4ccccc34)C2)cc1 |
| InChI | InChI=1S/C27H25NO4S/c1-18-12-14-20(15-13-18)33(31,32)28-16-24-22(9-5-11-26(24)29)25(17-28)27(30)23-10-4-7-19-6-2-3-8-21(19)23/h2-4,6-8,10,12-15,25H,5,9,11,16-17H2,1H3 |
| InChIKey | DDLQKNXKBGYUSA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |