C23H35N3O — CID 7329244
[(Z)-1-[(5S,8R,9R,10S)-10,17,17-trimethyl-4,5,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]ethylideneamino]urea (PubChem CID 7329244) has the molecular formula C23H35N3O and a molecular weight of 369.55 g/mol. Its IUPAC name is [(Z)-1-[(5S,8R,9R,10S)-10,17,17-trimethyl-4,5,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]ethylideneamino]urea.
| Compound Name | [(Z)-1-[(5S,8R,9R,10S)-10,17,17-trimethyl-4,5,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]ethylideneamino]urea |
|---|---|
| PubChem CID | 7329244 |
| Molecular Formula | C23H35N3O |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | [(Z)-1-[(5S,8R,9R,10S)-10,17,17-trimethyl-4,5,6,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]ethylideneamino]urea |
| SMILES | C/C(=N/NC(N)=O)C1=CC[C@@]2(C)[C@@H](CC[C@H]3C4=C(CC[C@H]32)C(C)(C)CC4)C1 |
| InChI | InChI=1S/C23H35N3O/c1-14(25-26-21(24)27)15-9-12-23(4)16(13-15)5-6-17-18-10-11-22(2,3)19(18)7-8-20(17)23/h9,16-17,20H,5-8,10-13H2,1-4H3,(H3,24,26,27)/b25-14-/t16-,17-,20+,23-/m0/s1 |
| InChIKey | IYDBAKSZTCQSKT-VGMJIPIPSA-N |
| XLogP | 5.31 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|