C27H24NO6+ — CID 73292566
13-(1,3-benzodioxol-5-ylmethyl)-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-2,4(8),9,15(23),16(20),21-hexaene (PubChem CID 73292566) has the molecular formula C27H24NO6+ and a molecular weight of 458.49 g/mol. Its IUPAC name is 13-(1,3-benzodioxol-5-ylmethyl)-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-2,4(8),9,15(23),16(20),21-hexaene.
| Compound Name | 13-(1,3-benzodioxol-5-ylmethyl)-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-2,4(8),9,15(23),16(20),21-hexaene |
|---|---|
| PubChem CID | 73292566 |
| Molecular Formula | C27H24NO6+ |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 13-(1,3-benzodioxol-5-ylmethyl)-5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-2,4(8),9,15(23),16(20),21-hexaene |
| SMILES | c1cc2c(cc1C[N+]13CCc4cc5c(cc4C1Cc1ccc4c(c1C3)OCO4)OCO5)OCO2 |
| InChI | InChI=1S/C27H24NO6/c1-3-22-24(31-13-29-22)7-16(1)11-28-6-5-18-9-25-26(33-14-32-25)10-19(18)21(28)8-17-2-4-23-27(20(17)12-28)34-15-30-23/h1-4,7,9-10,21H,5-6,8,11-15H2/q+1 |
| InChIKey | VBBUWOJUWZYHQH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|