C37H32ClNO2PS+ — CID 73294284
[5-(4-chloro-3-methylphenyl)-1-(4-methylphenyl)sulfonylpyrrol-3-yl]methyl-triphenylphosphanium (PubChem CID 73294284) has the molecular formula C37H32ClNO2PS+ and a molecular weight of 621.16 g/mol. Its IUPAC name is [5-(4-chloro-3-methylphenyl)-1-(4-methylphenyl)sulfonylpyrrol-3-yl]methyl-triphenylphosphanium.
| Compound Name | [5-(4-chloro-3-methylphenyl)-1-(4-methylphenyl)sulfonylpyrrol-3-yl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 73294284 |
| Molecular Formula | C37H32ClNO2PS+ |
| Molecular Weight | 621.16 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | [5-(4-chloro-3-methylphenyl)-1-(4-methylphenyl)sulfonylpyrrol-3-yl]methyl-triphenylphosphanium |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc2-c2ccc(Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C37H32ClNO2PS/c1-28-18-21-35(22-19-28)43(40,41)39-26-30(25-37(39)31-20-23-36(38)29(2)24-31)27-42(32-12-6-3-7-13-32,33-14-8-4-9-15-33)34-16-10-5-11-17-34/h3-26H,27H2,1-2H3/q+1 |
| InChIKey | OBBNUQUAMBJYMK-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.16 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|