C19H22N6 — CID 7329465
N-[(Z)-[(1S,6R)-4,6-dimethylcyclohex-3-en-1-yl]methylideneamino]-8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 7329465) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is N-[(Z)-[(1S,6R)-4,6-dimethylcyclohex-3-en-1-yl]methylideneamino]-8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(Z)-[(1S,6R)-4,6-dimethylcyclohex-3-en-1-yl]methylideneamino]-8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 7329465 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[(Z)-[(1S,6R)-4,6-dimethylcyclohex-3-en-1-yl]methylideneamino]-8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CC1=CC[C@H](/C=N\Nc2nnc3c(n2)[nH]c2ccc(C)cc23)[C@H](C)C1 |
| InChI | InChI=1S/C19H22N6/c1-11-4-6-14(13(3)8-11)10-20-24-19-22-18-17(23-25-19)15-9-12(2)5-7-16(15)21-18/h4-5,7,9-10,13-14H,6,8H2,1-3H3,(H2,21,22,24,25)/b20-10-/t13-,14-/m1/s1 |
| InChIKey | YUJSQARWAWWGRC-CYMDBXIPSA-N |
| XLogP | 4.20 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|