C17H26N3O2+ — CID 7330201
N'-(2-ethylphenyl)-N-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]oxamide (PubChem CID 7330201) has the molecular formula C17H26N3O2+ and a molecular weight of 304.41 g/mol. Its IUPAC name is N'-(2-ethylphenyl)-N-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]oxamide.
| Compound Name | N'-(2-ethylphenyl)-N-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]oxamide |
|---|---|
| PubChem CID | 7330201 |
| Molecular Formula | C17H26N3O2+ |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | N'-(2-ethylphenyl)-N-[[(2R)-1-ethylpyrrolidin-1-ium-2-yl]methyl]oxamide |
| SMILES | CCc1ccccc1NC(=O)C(=O)NC[C@H]1CCC[NH+]1CC |
| InChI | InChI=1S/C17H25N3O2/c1-3-13-8-5-6-10-15(13)19-17(22)16(21)18-12-14-9-7-11-20(14)4-2/h5-6,8,10,14H,3-4,7,9,11-12H2,1-2H3,(H,18,21)(H,19,22)/p+1/t14-/m1/s1 |
| InChIKey | ISIGWJLJZFEMRK-CQSZACIVSA-O |
| XLogP | 0.37 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|