C15H22N3O2+ — CID 7242434
N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-N'-phenyloxamide (PubChem CID 7242434) has the molecular formula C15H22N3O2+ and a molecular weight of 276.36 g/mol. Its IUPAC name is N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-N'-phenyloxamide.
| Compound Name | N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-N'-phenyloxamide |
|---|---|
| PubChem CID | 7242434 |
| Molecular Formula | C15H22N3O2+ |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | N-[[(2S)-1-ethylpyrrolidin-1-ium-2-yl]methyl]-N'-phenyloxamide |
| SMILES | CC[NH+]1CCC[C@H]1CNC(=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H21N3O2/c1-2-18-10-6-9-13(18)11-16-14(19)15(20)17-12-7-4-3-5-8-12/h3-5,7-8,13H,2,6,9-11H2,1H3,(H,16,19)(H,17,20)/p+1/t13-/m0/s1 |
| InChIKey | RVGUQPGNMZYGQO-ZDUSSCGKSA-O |
| XLogP | -0.19 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|