C21H17Cl2N3O3 — CID 73309261
1'-[3-(3,4-dichlorophenyl)prop-2-enyl]-1,3-dimethylspiro[imidazolidine-5,3'-indole]-2,2',4-trione (PubChem CID 73309261) has the molecular formula C21H17Cl2N3O3 and a molecular weight of 430.29 g/mol. Its IUPAC name is 1'-[3-(3,4-dichlorophenyl)prop-2-enyl]-1,3-dimethylspiro[imidazolidine-5,3'-indole]-2,2',4-trione.
| Compound Name | 1'-[3-(3,4-dichlorophenyl)prop-2-enyl]-1,3-dimethylspiro[imidazolidine-5,3'-indole]-2,2',4-trione |
|---|---|
| PubChem CID | 73309261 |
| Molecular Formula | C21H17Cl2N3O3 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 1'-[3-(3,4-dichlorophenyl)prop-2-enyl]-1,3-dimethylspiro[imidazolidine-5,3'-indole]-2,2',4-trione |
| SMILES | CN1C(=O)N(C)C2(C1=O)C(=O)N(CC=Cc1ccc(Cl)c(Cl)c1)c1ccccc12 |
| InChI | InChI=1S/C21H17Cl2N3O3/c1-24-18(27)21(25(2)20(24)29)14-7-3-4-8-17(14)26(19(21)28)11-5-6-13-9-10-15(22)16(23)12-13/h3-10,12H,11H2,1-2H3 |
| InChIKey | RIPSUFUPBNWWTF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|