C20H21N4O4+ — CID 7331352
(3R)-3-[4-(1,3-benzoxazol-2-yl)piperidin-1-ium-1-yl]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,5-dione (PubChem CID 7331352) has the molecular formula C20H21N4O4+ and a molecular weight of 381.41 g/mol. Its IUPAC name is (3R)-3-[4-(1,3-benzoxazol-2-yl)piperidin-1-ium-1-yl]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(1,3-benzoxazol-2-yl)piperidin-1-ium-1-yl]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7331352 |
| Molecular Formula | C20H21N4O4+ |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (3R)-3-[4-(1,3-benzoxazol-2-yl)piperidin-1-ium-1-yl]-1-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2,5-dione |
| SMILES | Cc1cc(N2C(=O)C[C@@H]([NH+]3CCC(c4nc5ccccc5o4)CC3)C2=O)no1 |
| InChI | InChI=1S/C20H20N4O4/c1-12-10-17(22-28-12)24-18(25)11-15(20(24)26)23-8-6-13(7-9-23)19-21-14-4-2-3-5-16(14)27-19/h2-5,10,13,15H,6-9,11H2,1H3/p+1/t15-/m1/s1 |
| InChIKey | OYUUDAFCLPJLGL-OAHLLOKOSA-O |
| XLogP | 1.22 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|