C30H40O8 — CID 73324030
7-hydroxy-12-[1-hydroxy-3-(4-methyl-6-oxo-2,3-dihydropyran-2-yl)prop-2-enyl]-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one (PubChem CID 73324030) has the molecular formula C30H40O8 and a molecular weight of 528.64 g/mol. Its IUPAC name is 7-hydroxy-12-[1-hydroxy-3-(4-methyl-6-oxo-2,3-dihydropyran-2-yl)prop-2-enyl]-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one.
| Compound Name | 7-hydroxy-12-[1-hydroxy-3-(4-methyl-6-oxo-2,3-dihydropyran-2-yl)prop-2-enyl]-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
|---|---|
| PubChem CID | 73324030 |
| Molecular Formula | C30H40O8 |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 7-hydroxy-12-[1-hydroxy-3-(4-methyl-6-oxo-2,3-dihydropyran-2-yl)prop-2-enyl]-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
| SMILES | C=C1CC(C)CC2CC=CC(CC=CC(=O)OC(C(O)C=CC3CC(C)=CC(=O)O3)CC3OC3C(O)C1)O2 |
| InChI | InChI=1S/C30H40O8/c1-18-12-19(2)15-25(32)30-27(38-30)17-26(24(31)11-10-23-14-20(3)16-29(34)36-23)37-28(33)9-5-7-21-6-4-8-22(13-18)35-21/h4-6,9-11,16,18,21-27,30-32H,2,7-8,12-15,17H2,1,3H3 |
| InChIKey | NUXJLCUOWNGMFR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|