C31H44O6 — CID 89241228
(7S,10S,15Z)-7-hydroxy-12-[(E)-1-hydroxy-3-(3-methylcyclohex-2-en-1-yl)prop-2-enyl]-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one (PubChem CID 89241228) has the molecular formula C31H44O6 and a molecular weight of 512.69 g/mol. Its IUPAC name is (7S,10S,15Z)-7-hydroxy-12-[(E)-1-hydroxy-3-(3-methylcyclohex-2-en-1-yl)prop-2-enyl]-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one.
| Compound Name | (7S,10S,15Z)-7-hydroxy-12-[(E)-1-hydroxy-3-(3-methylcyclohex-2-en-1-yl)prop-2-enyl]-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
|---|---|
| PubChem CID | 89241228 |
| Molecular Formula | C31H44O6 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | (7S,10S,15Z)-7-hydroxy-12-[(E)-1-hydroxy-3-(3-methylcyclohex-2-en-1-yl)prop-2-enyl]-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
| SMILES | C=C1CC(C)CC2CC=CC(C/C=C/C(=O)OC(C(O)/C=C/C3C=C(C)CCC3)C[C@@H]3OC3[C@@H](O)C1)O2 |
| InChI | InChI=1S/C31H44O6/c1-20-7-4-8-23(16-20)13-14-26(32)28-19-29-31(37-29)27(33)18-22(3)15-21(2)17-25-11-5-9-24(35-25)10-6-12-30(34)36-28/h5-6,9,12-14,16,21,23-29,31-33H,3-4,7-8,10-11,15,17-19H2,1-2H3/b12-6+,14-13+/t21?,23?,24?,25?,26?,27-,28?,29-,31?/m0/s1 |
| InChIKey | GEOIKYYTXHSVMJ-DNWUSLKASA-N |
| XLogP | 5.12 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|