C25H29F2N5O4S — CID 73331098
5-amino-N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-2-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 73331098) has the molecular formula C25H29F2N5O4S and a molecular weight of 533.60 g/mol. Its IUPAC name is 5-amino-N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-2-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 5-amino-N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-2-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 73331098 |
| Molecular Formula | C25H29F2N5O4S |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 5-amino-N-[4-[(1R,3R,4R,5S)-3-amino-4-hydroxy-5-methylcyclohexyl]-3-pyridinyl]-2-[2,6-difluoro-4-(2-methoxyethoxy)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | COCCOc1cc(F)c(-c2nc(C(=O)Nc3cnccc3[C@H]3C[C@@H](N)[C@H](O)[C@@H](C)C3)c(N)s2)c(F)c1 |
| InChI | InChI=1S/C25H29F2N5O4S/c1-12-7-13(8-18(28)22(12)33)15-3-4-30-11-19(15)31-24(34)21-23(29)37-25(32-21)20-16(26)9-14(10-17(20)27)36-6-5-35-2/h3-4,9-13,18,22,33H,5-8,28-29H2,1-2H3,(H,31,34)/t12-,13+,18+,22+/m0/s1 |
| InChIKey | RUXJPJSNTOEUBR-DVPGJPETSA-N |
| XLogP | 3.54 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|