C23H34ClN3O6 — CID 73332094
2-tert-butyl-4-chloro-5-[[6-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]-3-pyridinyl]methoxy]-3H-pyridazin-3-ol (PubChem CID 73332094) has the molecular formula C23H34ClN3O6 and a molecular weight of 483.99 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[[6-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]-3-pyridinyl]methoxy]-3H-pyridazin-3-ol.
| Compound Name | 2-tert-butyl-4-chloro-5-[[6-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]-3-pyridinyl]methoxy]-3H-pyridazin-3-ol |
|---|---|
| PubChem CID | 73332094 |
| Molecular Formula | C23H34ClN3O6 |
| Molecular Weight | 483.99 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[[6-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]-3-pyridinyl]methoxy]-3H-pyridazin-3-ol |
| SMILES | CC(C)(C)N1N=CC(OCc2ccc(OCCOCCOC3CCCCO3)nc2)=C(Cl)C1O |
| InChI | InChI=1S/C23H34ClN3O6/c1-23(2,3)27-22(28)21(24)18(15-26-27)33-16-17-7-8-19(25-14-17)30-12-10-29-11-13-32-20-6-4-5-9-31-20/h7-8,14-15,20,22,28H,4-6,9-13,16H2,1-3H3 |
| InChIKey | CNFYDXBAPYAWAX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.99 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|