C18H27NO4 — CID 144830019
5-(3-methylbut-2-enoxymethyl)-2-[2-(oxan-2-yloxy)ethoxy]pyridine (PubChem CID 144830019) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is 5-(3-methylbut-2-enoxymethyl)-2-[2-(oxan-2-yloxy)ethoxy]pyridine.
| Compound Name | 5-(3-methylbut-2-enoxymethyl)-2-[2-(oxan-2-yloxy)ethoxy]pyridine |
|---|---|
| PubChem CID | 144830019 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 5-(3-methylbut-2-enoxymethyl)-2-[2-(oxan-2-yloxy)ethoxy]pyridine |
| SMILES | CC(C)=CCOCc1ccc(OCCOC2CCCCO2)nc1 |
| InChI | InChI=1S/C18H27NO4/c1-15(2)8-10-20-14-16-6-7-17(19-13-16)21-11-12-23-18-5-3-4-9-22-18/h6-8,13,18H,3-5,9-12,14H2,1-2H3 |
| InChIKey | JYTVXUCATMZYFM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|