C31H44N2O5Si — CID 73333980
methyl 6-[(4R,5R)-1,3-dibenzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxoimidazolidin-4-yl]-6-oxohexanoate (PubChem CID 73333980) has the molecular formula C31H44N2O5Si and a molecular weight of 552.79 g/mol. Its IUPAC name is methyl 6-[(4R,5R)-1,3-dibenzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxoimidazolidin-4-yl]-6-oxohexanoate.
| Compound Name | methyl 6-[(4R,5R)-1,3-dibenzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxoimidazolidin-4-yl]-6-oxohexanoate |
|---|---|
| PubChem CID | 73333980 |
| Molecular Formula | C31H44N2O5Si |
| Molecular Weight | 552.79 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | methyl 6-[(4R,5R)-1,3-dibenzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-oxoimidazolidin-4-yl]-6-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)[C@H]1[C@H](CO[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C31H44N2O5Si/c1-31(2,3)39(5,6)38-23-26-29(27(34)19-13-14-20-28(35)37-4)33(22-25-17-11-8-12-18-25)30(36)32(26)21-24-15-9-7-10-16-24/h7-12,15-18,26,29H,13-14,19-23H2,1-6H3/t26-,29+/m0/s1 |
| InChIKey | GALMHVITYCMYLW-LITSAYRRSA-N |
| XLogP | 6.19 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.79 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|