C27H32N2O5S — CID 73333982
methyl 6-[(4R,5R)-5-(acetylsulfanylmethyl)-1,3-dibenzyl-2-oxoimidazolidin-4-yl]-6-oxohexanoate (PubChem CID 73333982) has the molecular formula C27H32N2O5S and a molecular weight of 496.63 g/mol. Its IUPAC name is methyl 6-[(4R,5R)-5-(acetylsulfanylmethyl)-1,3-dibenzyl-2-oxoimidazolidin-4-yl]-6-oxohexanoate.
| Compound Name | methyl 6-[(4R,5R)-5-(acetylsulfanylmethyl)-1,3-dibenzyl-2-oxoimidazolidin-4-yl]-6-oxohexanoate |
|---|---|
| PubChem CID | 73333982 |
| Molecular Formula | C27H32N2O5S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | methyl 6-[(4R,5R)-5-(acetylsulfanylmethyl)-1,3-dibenzyl-2-oxoimidazolidin-4-yl]-6-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)[C@H]1[C@H](CSC(C)=O)N(Cc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C27H32N2O5S/c1-20(30)35-19-23-26(24(31)15-9-10-16-25(32)34-2)29(18-22-13-7-4-8-14-22)27(33)28(23)17-21-11-5-3-6-12-21/h3-8,11-14,23,26H,9-10,15-19H2,1-2H3/t23-,26+/m0/s1 |
| InChIKey | QDGREPUVDXHPON-JYFHCDHNSA-N |
| XLogP | 4.44 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|