C31H27N3O5 — CID 73334112
benzyl (4R,6S)-4-benzyl-15,16-dimethoxy-3-oxo-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),7(12),8,10,13,15-hexaene-5-carboxylate (PubChem CID 73334112) has the molecular formula C31H27N3O5 and a molecular weight of 521.57 g/mol. Its IUPAC name is benzyl (4R,6S)-4-benzyl-15,16-dimethoxy-3-oxo-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),7(12),8,10,13,15-hexaene-5-carboxylate.
| Compound Name | benzyl (4R,6S)-4-benzyl-15,16-dimethoxy-3-oxo-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),7(12),8,10,13,15-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 73334112 |
| Molecular Formula | C31H27N3O5 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | benzyl (4R,6S)-4-benzyl-15,16-dimethoxy-3-oxo-2,5,11-triazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),7(12),8,10,13,15-hexaene-5-carboxylate |
| SMILES | COc1cc2c(cc1OC)N1C(=O)[C@@H](Cc3ccccc3)N(C(=O)OCc3ccccc3)[C@H]1c1cccnc1-2 |
| InChI | InChI=1S/C31H27N3O5/c1-37-26-17-23-24(18-27(26)38-2)33-29(22-14-9-15-32-28(22)23)34(31(36)39-19-21-12-7-4-8-13-21)25(30(33)35)16-20-10-5-3-6-11-20/h3-15,17-18,25,29H,16,19H2,1-2H3/t25-,29+/m1/s1 |
| InChIKey | HTFKNGXQZFHZAJ-IRPSRAIASA-N |
| XLogP | 5.37 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |