C15H18O6 — CID 73334548
ethyl 2-(5,8-dimethoxy-4-oxo-1H-isochromen-3-yl)acetate (PubChem CID 73334548) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is ethyl 2-(5,8-dimethoxy-4-oxo-1H-isochromen-3-yl)acetate.
| Compound Name | ethyl 2-(5,8-dimethoxy-4-oxo-1H-isochromen-3-yl)acetate |
|---|---|
| PubChem CID | 73334548 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | ethyl 2-(5,8-dimethoxy-4-oxo-1H-isochromen-3-yl)acetate |
| SMILES | CCOC(=O)CC1OCc2c(OC)ccc(OC)c2C1=O |
| InChI | InChI=1S/C15H18O6/c1-4-20-13(16)7-12-15(17)14-9(8-21-12)10(18-2)5-6-11(14)19-3/h5-6,12H,4,7-8H2,1-3H3 |
| InChIKey | GDSMZIPSTNKTLO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |