C15H30N2O5 — CID 73335247
(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-N-methyl-1-(5-methylhexyl)piperidine-2-carboxamide (PubChem CID 73335247) has the molecular formula C15H30N2O5 and a molecular weight of 318.41 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-N-methyl-1-(5-methylhexyl)piperidine-2-carboxamide.
| Compound Name | (2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-N-methyl-1-(5-methylhexyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 73335247 |
| Molecular Formula | C15H30N2O5 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-N-methyl-1-(5-methylhexyl)piperidine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@@H](CO)N1CCCCC(C)C |
| InChI | InChI=1S/C15H30N2O5/c1-9(2)6-4-5-7-17-10(8-18)12(19)14(21)13(20)11(17)15(22)16-3/h9-14,18-21H,4-8H2,1-3H3,(H,16,22)/t10-,11+,12-,13-,14+/m1/s1 |
| InChIKey | LADQDCZISQOLJA-ITGHMWBKSA-N |
| XLogP | -1.31 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|