C26H46N2O5 — CID 71484733
(2R,3S,4S,5S)-N-[5-(1-adamantylmethoxy)pentyl]-1-butyl-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidine-2-carboxamide (PubChem CID 71484733) has the molecular formula C26H46N2O5 and a molecular weight of 466.66 g/mol. Its IUPAC name is (2R,3S,4S,5S)-N-[5-(1-adamantylmethoxy)pentyl]-1-butyl-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4S,5S)-N-[5-(1-adamantylmethoxy)pentyl]-1-butyl-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 71484733 |
| Molecular Formula | C26H46N2O5 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | (2R,3S,4S,5S)-N-[5-(1-adamantylmethoxy)pentyl]-1-butyl-3,4-dihydroxy-5-(hydroxymethyl)pyrrolidine-2-carboxamide |
| SMILES | CCCCN1[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]1C(=O)NCCCCCOCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H46N2O5/c1-2-3-8-28-21(16-29)23(30)24(31)22(28)25(32)27-7-5-4-6-9-33-17-26-13-18-10-19(14-26)12-20(11-18)15-26/h18-24,29-31H,2-17H2,1H3,(H,27,32)/t18?,19?,20?,21-,22+,23-,24-,26?/m0/s1 |
| InChIKey | JUEKQDYXUAIYRD-LONCHFBLSA-N |
| XLogP | 2.07 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|