C22H39NO3 — CID 70691535
(2S,3R)-1-[5-(1-adamantylmethoxy)pentyl]-2-(hydroxymethyl)piperidin-3-ol (PubChem CID 70691535) has the molecular formula C22H39NO3 and a molecular weight of 365.56 g/mol. Its IUPAC name is (2S,3R)-1-[5-(1-adamantylmethoxy)pentyl]-2-(hydroxymethyl)piperidin-3-ol.
| Compound Name | (2S,3R)-1-[5-(1-adamantylmethoxy)pentyl]-2-(hydroxymethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 70691535 |
| Molecular Formula | C22H39NO3 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.29 |
| IUPAC Name | (2S,3R)-1-[5-(1-adamantylmethoxy)pentyl]-2-(hydroxymethyl)piperidin-3-ol |
| SMILES | OC[C@H]1[C@H](O)CCCN1CCCCCOCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H39NO3/c24-15-20-21(25)5-4-7-23(20)6-2-1-3-8-26-16-22-12-17-9-18(13-22)11-19(10-17)14-22/h17-21,24-25H,1-16H2/t17?,18?,19?,20-,21+,22?/m0/s1 |
| InChIKey | FSVJCNOLLRABCZ-YOHGGFGZSA-N |
| XLogP | 3.21 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|