C19H17F3N4O2 — CID 73339178
8-phenyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazine-3,4-dione (PubChem CID 73339178) has the molecular formula C19H17F3N4O2 and a molecular weight of 390.37 g/mol. Its IUPAC name is 8-phenyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazine-3,4-dione.
| Compound Name | 8-phenyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazine-3,4-dione |
|---|---|
| PubChem CID | 73339178 |
| Molecular Formula | C19H17F3N4O2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 8-phenyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazine-3,4-dione |
| SMILES | O=C1C(=O)N2CCN(c3ccccc3)C2NN1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H17F3N4O2/c20-19(21,22)14-6-4-5-13(11-14)12-26-17(28)16(27)25-10-9-24(18(25)23-26)15-7-2-1-3-8-15/h1-8,11,18,23H,9-10,12H2 |
| InChIKey | RKSCCHCIVJZBPF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|