C23H29N7O3 — CID 73339912
N-[2-(1H-indol-3-yl)ethyl]-N'-[5-methyl-2-(4-oxo-6-propyl-1,3-diazinan-2-yl)pyrazol-3-yl]oxamide (PubChem CID 73339912) has the molecular formula C23H29N7O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-N'-[5-methyl-2-(4-oxo-6-propyl-1,3-diazinan-2-yl)pyrazol-3-yl]oxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-N'-[5-methyl-2-(4-oxo-6-propyl-1,3-diazinan-2-yl)pyrazol-3-yl]oxamide |
|---|---|
| PubChem CID | 73339912 |
| Molecular Formula | C23H29N7O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-N'-[5-methyl-2-(4-oxo-6-propyl-1,3-diazinan-2-yl)pyrazol-3-yl]oxamide |
| SMILES | CCCC1CC(=O)NC(n2nc(C)cc2NC(=O)C(=O)NCCc2c[nH]c3ccccc23)N1 |
| InChI | InChI=1S/C23H29N7O3/c1-3-6-16-12-20(31)28-23(26-16)30-19(11-14(2)29-30)27-22(33)21(32)24-10-9-15-13-25-18-8-5-4-7-17(15)18/h4-5,7-8,11,13,16,23,25-26H,3,6,9-10,12H2,1-2H3,(H,24,32)(H,27,33)(H,28,31) |
| InChIKey | UQVHCHAOXXSIHC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|